CAS 941716-91-2 is the registry number for 2-Pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid (CAS 941716-91-2) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: KPQGRYOIUITVHX-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-pyrrolidin-1-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | KPQGRYOIUITVHX-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)