cas: 2645-24-1 — see every product listed under this CAS number, including other names
2-Thiocyanatonaphthalene, 95-<97% (CAS 2645-24-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6265-95-97-5g |
| cas | 2645-24-1 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 9227.24 Pln | |
| Hoffman Fine Chemicals | 10g | 14580.06 Pln | |
| Hoffman Fine Chemicals | 25g | 28852.12 Pln | |
| Hoffman Fine Chemicals | 50g | 45976.04 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Naphthalen-2-yl thiocyanate (CAS 2645-24-1) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: naphthalen-2-yl thiocyanate. InChIKey: MLFHAFHQSNYRDD-UHFFFAOYSA-N.
| Molecular formula | C11H7NS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | naphthalen-2-yl thiocyanate |
| InChIKey | MLFHAFHQSNYRDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)SC#N |
Computed by PubChem (NCBI)