CAS 318-69-4 is the registry number for Benzothieno[3,2-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[1]benzothiolo[3,2-b]pyridine (CAS 318-69-4) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: [1]benzothiolo[3,2-b]pyridine. InChIKey: WIUZHVZUGQDRHZ-UHFFFAOYSA-N.
| Molecular formula | C11H7NS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | [1]benzothiolo[3,2-b]pyridine |
| InChIKey | WIUZHVZUGQDRHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=CC=N3 |
Computed by PubChem (NCBI)