Products 76010-78-1
CAS 76010-78-1 is the registry number for (E)-3-(Benzo[b]thiophen-3-yl)acrylonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(1-benzothiophen-3-yl)prop-2-enenitrile (CAS 76010-78-1) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: (E)-3-(1-benzothiophen-3-yl)prop-2-enenitrile. InChIKey: PWYMKHLCQIDLKX-ONEGZZNKSA-N.
| Molecular formula | C11H7NS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | (E)-3-(1-benzothiophen-3-yl)prop-2-enenitrile |
| InChIKey | PWYMKHLCQIDLKX-ONEGZZNKSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)/C=C/C#N |
Computed by PubChem (NCBI)