CAS 380626-35-7 is the registry number for 3-Thien-2-ylbenzonitrile, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
3-thiophen-2-ylbenzonitrile (CAS 380626-35-7) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: 3-thiophen-2-ylbenzonitrile. InChIKey: DIILPQRSOQWSCU-UHFFFAOYSA-N.
| Molecular formula | C11H7NS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 3-thiophen-2-ylbenzonitrile |
| InChIKey | DIILPQRSOQWSCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=CS2)C#N |
Computed by PubChem (NCBI)