CAS 2645-24-1 is the registry number for 2-Thiocyanatonaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
Naphthalen-2-yl thiocyanate (CAS 2645-24-1) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: naphthalen-2-yl thiocyanate. InChIKey: MLFHAFHQSNYRDD-UHFFFAOYSA-N.
| Molecular formula | C11H7NS |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | naphthalen-2-yl thiocyanate |
| InChIKey | MLFHAFHQSNYRDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)SC#N |
Computed by PubChem (NCBI)