Products 2645-24-1

CAS 2645-24-1 is the registry number for 2-Thiocyanatonaphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.

Naphthalen-2-yl thiocyanate (CAS 2645-24-1) is a chemical compound with the molecular formula C11H7NS and a molecular weight of 185.25 g/mol. IUPAC name: naphthalen-2-yl thiocyanate. InChIKey: MLFHAFHQSNYRDD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7NS
Molecular weight185.25 g/mol
IUPAC namenaphthalen-2-yl thiocyanate
InChIKeyMLFHAFHQSNYRDD-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)SC#N

Computed by PubChem (NCBI)