cas: 447-31-4 — see every product listed under this CAS number, including other names
2-chloro-1,2-diphenylethan-1-one (CAS 447-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358265-1G |
| cas | 447-31-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 25g | 1289.15 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-1,2-diphenylethanone (CAS 447-31-4) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-chloro-1,2-diphenylethanone. InChIKey: RXDYOLRABMJTEF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-chloro-1,2-diphenylethanone |
| InChIKey | RXDYOLRABMJTEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)