cas: 447-31-4 — see every product listed under this CAS number, including other names
2-chloro-1,2-diphenylethanone, ≥98%, ≥98% (CAS 447-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P0S-1g |
| cas | 447-31-4 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 707.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-1,2-diphenylethanone (CAS 447-31-4) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-chloro-1,2-diphenylethanone. InChIKey: RXDYOLRABMJTEF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-chloro-1,2-diphenylethanone |
| InChIKey | RXDYOLRABMJTEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)