cas: 30894-93-0 — see every product listed under this CAS number, including other names
2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine, 99%, 99% (CAS 30894-93-0) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 1kg, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131K9D-250g |
| cas | 30894-93-0 |
| size | 250g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 1782.80 Pln | |
| Chemat | 500g | 2889.60 Pln | |
| Chemat | 1kg | 5008.40 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 578.00 Pln | |
| Chemat | 50g | 750.80 Pln | |
| Chemat | 100g | 1096.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine (CAS 30894-93-0) is a chemical compound with the molecular formula C15H9Cl2N3 and a molecular weight of 302.2 g/mol. IUPAC name: 2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine. InChIKey: HLRNODHPMNYHKS-UHFFFAOYSA-N.
| Molecular formula | C15H9Cl2N3 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | 2-chloro-4-(4-chlorophenyl)-6-phenyl-1,3,5-triazine |
| InChIKey | HLRNODHPMNYHKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)