cas: 20197-97-1 — see every product listed under this CAS number, including other names
2-chloro-6-methoxy-1,4-dihydroquinazolin-4-one, 95% (CAS 20197-97-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F751210-10G |
| cas | 20197-97-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 3059.36 Pln | |
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 357.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-methoxy-3H-quinazolin-4-one (CAS 20197-97-1) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 2-chloro-6-methoxy-3H-quinazolin-4-one. InChIKey: RZBPTLOVZCUBRS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2-chloro-6-methoxy-3H-quinazolin-4-one |
| InChIKey | RZBPTLOVZCUBRS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(NC2=O)Cl |
Computed by PubChem (NCBI)