CAS 1073495-87-0 is the registry number for 3-Chloro-6-methoxy-1,5-naphthyridin-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one (CAS 1073495-87-0) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one. InChIKey: BBRMUSGOTQCSET-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one |
| InChIKey | BBRMUSGOTQCSET-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC=C(C2=O)Cl |
Computed by PubChem (NCBI)