CAS 1204811-24-4 is the registry number for Quinazoline-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
Quinazoline-2-carboxylic acid;hydrochloride (CAS 1204811-24-4) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: quinazoline-2-carboxylic acid;hydrochloride. InChIKey: TYQONKJAALXRAF-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | quinazoline-2-carboxylic acid;hydrochloride |
| InChIKey | TYQONKJAALXRAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC(=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)