CAS 724787-12-6 appears in our catalog under these names: 3-Chloro-6-methoxy-1,5-naphthyridin-4-ol, 95%, 3-Chloro-6-methoxy-1,5-naphthyridin-4-ol, 97%, 3-Chloro-6-methoxy-1,5-naphthyridin-4-ol, 97%, 97%, 3-chloro-6-methoxy-1,4-dihydro-1,5-naphthyridin-4-one, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one (CAS 724787-12-6) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one. InChIKey: BBRMUSGOTQCSET-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 3-chloro-6-methoxy-1H-1,5-naphthyridin-4-one |
| InChIKey | BBRMUSGOTQCSET-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC=C(C2=O)Cl |
Computed by PubChem (NCBI)