CAS 1206248-90-9 is the registry number for Methyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate (CAS 1206248-90-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: AVXWKRQPFKPVOW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 6-chloroimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | AVXWKRQPFKPVOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C=C(C=CC2=N1)Cl |
Computed by PubChem (NCBI)