cas: 1365964-78-8 — see every product listed under this CAS number, including other names
2-methylimidazo[1,2-a]pyridine-7-carboxylic acid hydrochloride, 95% (CAS 1365964-78-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 500mg, 2.5g, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JD-9923-1g |
| cas | 1365964-78-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 50mg | 310.33 Pln | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 500mg | 1226.67 Pln | |
| Fluorochem | 1g | 1497.41 Pln | |
| Fluorochem | 2.5g | 3663.31 Pln | |
| Fluorochem | 5g | 7266.21 Pln | |
| Fluorochem | 10g | 14482.42 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-methylimidazo[1,2-a]pyridine-7-carboxylic acid;hydrochloride (CAS 1365964-78-8) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-methylimidazo[1,2-a]pyridine-7-carboxylic acid;hydrochloride. InChIKey: UWFOHHGBFBQASR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-methylimidazo[1,2-a]pyridine-7-carboxylic acid;hydrochloride |
| InChIKey | UWFOHHGBFBQASR-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=CC(=CC2=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)