CAS 127657-47-0 appears in our catalog under these names: 2-(Imidazo[1,2-a]pyridin-2-yl)acetic acid hydrochloride, 95%, 2-{Imidazo(1,2-a)pyridin-2-yl}acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-imidazo[1,2-a]pyridin-2-ylacetic acid;hydrochloride (CAS 127657-47-0) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-imidazo[1,2-a]pyridin-2-ylacetic acid;hydrochloride. InChIKey: WFZSCQPAHBSKLE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-imidazo[1,2-a]pyridin-2-ylacetic acid;hydrochloride |
| InChIKey | WFZSCQPAHBSKLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)CC(=O)O.Cl |
Computed by PubChem (NCBI)