CAS 1890343-16-4 is the registry number for Imidazo[1,2-a]pyridine-8-carboxylic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl imidazo[1,2-a]pyridine-8-carboxylate;hydrochloride (CAS 1890343-16-4) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl imidazo[1,2-a]pyridine-8-carboxylate;hydrochloride. InChIKey: SPZWZNLBQSHSLQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl imidazo[1,2-a]pyridine-8-carboxylate;hydrochloride |
| InChIKey | SPZWZNLBQSHSLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CN2C1=NC=C2.Cl |
Computed by PubChem (NCBI)