CAS 93089-86-2 is the registry number for 2-Methyl-1h-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 93089-86-2) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: MBTOZVMYBGBPOH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | MBTOZVMYBGBPOH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)