Products 93089-86-2

CAS 93089-86-2 is the registry number for 2-Methyl-1h-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 93089-86-2) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: MBTOZVMYBGBPOH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClN2O2
Molecular weight212.63 g/mol
IUPAC name2-methyl-3H-benzimidazole-5-carboxylic acid;hydrochloride
InChIKeyMBTOZVMYBGBPOH-UHFFFAOYSA-N
SMILESCC1=NC2=C(N1)C=C(C=C2)C(=O)O.Cl

Computed by PubChem (NCBI)