CAS 2305255-94-9 is the registry number for Methyl 1h-indazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 1H-indazole-5-carboxylate;hydrochloride (CAS 2305255-94-9) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl 1H-indazole-5-carboxylate;hydrochloride. InChIKey: XSIPNWKQZSPPPW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl 1H-indazole-5-carboxylate;hydrochloride |
| InChIKey | XSIPNWKQZSPPPW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NN=C2.Cl |
Computed by PubChem (NCBI)