Products 2305255-94-9

CAS 2305255-94-9 is the registry number for Methyl 1h-indazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 1H-indazole-5-carboxylate;hydrochloride (CAS 2305255-94-9) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl 1H-indazole-5-carboxylate;hydrochloride. InChIKey: XSIPNWKQZSPPPW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClN2O2
Molecular weight212.63 g/mol
IUPAC namemethyl 1H-indazole-5-carboxylate;hydrochloride
InChIKeyXSIPNWKQZSPPPW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)NN=C2.Cl

Computed by PubChem (NCBI)