cas: 1357351-87-1 — see every product listed under this CAS number, including other names
2-tert-Butyl 5-ethyl 7-oxo-2,6-diazaspiro(3.4)octane-2,5-dicarboxylate, 97% (CAS 1357351-87-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A179561-1g |
| cas | 1357351-87-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10629.22 Pln | |
| AmBeed | 250mg | 4633.51 Pln | |
| AmBeed | 5g | 36291.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate (CAS 1357351-87-1) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate. InChIKey: HVOJRYNWIYULON-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate |
| InChIKey | HVOJRYNWIYULON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2(CC(=O)N1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)