cas: 1408074-81-6 — see every product listed under this CAS number, including other names
2-tert-butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate 98% (CAS 1408074-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A629042-100mg |
| cas | 1408074-81-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 3630.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A629042 |
2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate (CAS 1408074-81-6) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate. InChIKey: FZDJDEXABKVIDA-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | FZDJDEXABKVIDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)C(=O)OC |
Computed by PubChem (NCBI)