cas: 1357354-49-4 — see every product listed under this CAS number, including other names
2-tert-butyl 9-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate, 96%, 96% (CAS 1357354-49-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUDL-100mg |
| cas | 1357354-49-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 500mg | 1499.60 Pln | |
| Chemat | 1g | 2195.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate (CAS 1357354-49-4) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate. InChIKey: LKKYIMUKDUHHII-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate |
| InChIKey | LKKYIMUKDUHHII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCC12CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)