2H-DIBENZO[E,G]ISOINDOLE, 95%
cas: 235-93-8 — see every product listed under this CAS number, including other names
2H-DIBENZO[E,G]ISOINDOLE, 95% (CAS 235-93-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F852526-25MG |
| cas | 235-93-8 |
| size | 25mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 737.26 Pln | |
| Fluorochem | 50mg | 1138.16 Pln | |
| Fluorochem | 100mg | 1757.73 Pln | |
| Fluorochem | 250mg | 2923.99 Pln | |
| Ambeed | 250mg | 1838.88 Pln | |
| Ambeed | 1g | 4842.62 Pln | |
| Chemat | 25mg | 515.60 Pln | |
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1216.40 Pln | |
| Chemat | 250mg | 2027.60 Pln | |
| Chemat | 1g | 5358.80 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2H-phenanthro[9,10-c]pyrrole (CAS 235-93-8) is a chemical compound with the molecular formula C16H11N and a molecular weight of 217.26 g/mol. IUPAC name: 2H-phenanthro[9,10-c]pyrrole. InChIKey: SHNNRQRIBNWMNI-UHFFFAOYSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2H-phenanthro[9,10-c]pyrrole |
| InChIKey | SHNNRQRIBNWMNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=CNC=C24 |
Computed by PubChem (NCBI)