Products 200-22-6
CAS 200-22-6 is the registry number for 7H-Benzo[kl]acridine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (CAS 200-22-6) is a chemical compound with the molecular formula C16H11N and a molecular weight of 217.26 g/mol. IUPAC name: 8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene. InChIKey: MCXFBJRDLNFXHM-UHFFFAOYSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| InChIKey | MCXFBJRDLNFXHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC4=C3C(=CC=C4)N2 |
Computed by PubChem (NCBI)