Products 128008-86-6
CAS 128008-86-6 appears in our catalog under these names: 1-Aminopyrene-d9, >95% (HPLC), 1-Aminopyrene-d9, 98 atom % D, min 98% Chemical Purity, 1–Aminopyrene–d9, 1-Pyrenamin-d9. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 0,01g, 0,005g, 50mg, 1 mg, 5 mg.
2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-amine (CAS 128008-86-6) is a chemical compound with the molecular formula C16H11N and a molecular weight of 226.32 g/mol. IUPAC name: 2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-amine. InChIKey: YZVWKHVRBDQPMQ-LOIXRAQWSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-amine |
| InChIKey | YZVWKHVRBDQPMQ-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C2=C3C(=C1[2H])C(=C(C4=C(C(=C(C(=C43)C(=C2[2H])[2H])[2H])[2H])N)[2H])[2H])[2H] |
Computed by PubChem (NCBI)