CAS 183022-66-4 is the registry number for 4-((4-Ethynylphenyl)ethynyl)aniline, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-[2-(4-ethynylphenyl)ethynyl]aniline (CAS 183022-66-4) is a chemical compound with the molecular formula C16H11N and a molecular weight of 217.26 g/mol. IUPAC name: 4-[2-(4-ethynylphenyl)ethynyl]aniline. InChIKey: POAQSSUQAZUOTG-UHFFFAOYSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 4-[2-(4-ethynylphenyl)ethynyl]aniline |
| InChIKey | POAQSSUQAZUOTG-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C#CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)