CAS 2961-76-4 appears in our catalog under these names: 2–(Anthracen–9–yl)acetonitrile, 2-(Anthracen-9-yl)acetonitrile 95+%, 2-(Anthracen-9-yl)acetonitrile, 95+%, 95+%, 2-(ANTHRACEN-9-YL)ACETONITRILE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-anthracen-9-ylacetonitrile (CAS 2961-76-4) is a chemical compound with the molecular formula C16H11N and a molecular weight of 217.26 g/mol. IUPAC name: 2-anthracen-9-ylacetonitrile. InChIKey: MUTCNFLGBMSLTA-UHFFFAOYSA-N.
| Molecular formula | C16H11N |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-anthracen-9-ylacetonitrile |
| InChIKey | MUTCNFLGBMSLTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CC#N |
Computed by PubChem (NCBI)