cas: 873056-60-1 — see every product listed under this CAS number, including other names
3',5'-Difluoro-[1,1'-biphenyl]-2-amine, 97% (CAS 873056-60-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210571-500MG |
| cas | 873056-60-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1028.82 Pln | |
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3,5-difluorophenyl)aniline (CAS 873056-60-1) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(3,5-difluorophenyl)aniline. InChIKey: CYILCTRYEHZDGM-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)aniline |
| InChIKey | CYILCTRYEHZDGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)