CAS 873056-60-1 appears in our catalog under these names: 2-(3,5-Difluorophenyl)aniline, 96%, 3',5'-Difluoro-(1,1'-biphenyl)-2-amine, 96%, 2-(3,5-Difluorophenyl)aniline, 3',5'-Difluoro-[1,1'-biphenyl]-2-amine, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2,5g, 500mg.
2-(3,5-difluorophenyl)aniline (CAS 873056-60-1) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(3,5-difluorophenyl)aniline. InChIKey: CYILCTRYEHZDGM-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)aniline |
| InChIKey | CYILCTRYEHZDGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)