CAS 160521-67-5 is the registry number for 2',4'-Difluoro-[1,1'-biphenyl]-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,4-difluorophenyl)aniline (CAS 160521-67-5) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 3-(2,4-difluorophenyl)aniline. InChIKey: WZTYCOKUYUEBMA-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)aniline |
| InChIKey | WZTYCOKUYUEBMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)