CAS 1208083-15-1 is the registry number for 4-Amino-3,5-difluorobiphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,6-difluoro-4-phenylaniline (CAS 1208083-15-1) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2,6-difluoro-4-phenylaniline. InChIKey: YXZRXSMPZIMQCT-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2,6-difluoro-4-phenylaniline |
| InChIKey | YXZRXSMPZIMQCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)F)N)F |
Computed by PubChem (NCBI)