Products 873056-62-3
CAS 873056-62-3 appears in our catalog under these names: 3''，4''–difluoro–(1，1''–biphenyl)–2–amine, 3',4'-Difluoro[1,1'-biphenyl]-2-amine, 95%, 3',4'-Difluoro-(1,1'-biphenyl)-2-amine, 95%, 3',4'-Difluoro-[1,1'-biphenyl]-2-amine 98%, 3',4'-Difluoro[1,1'-biphenyl]-2-amine, 98%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 500mg.
2-(3,4-difluorophenyl)aniline (CAS 873056-62-3) is a chemical compound with the molecular formula C12H9F2N and a molecular weight of 205.20 g/mol. IUPAC name: 2-(3,4-difluorophenyl)aniline. InChIKey: HFHHGKVFBPGNTR-UHFFFAOYSA-N.
| Molecular formula | C12H9F2N |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)aniline |
| InChIKey | HFHHGKVFBPGNTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)F)F)N |
Computed by PubChem (NCBI)