cas: 223575-93-7 — see every product listed under this CAS number, including other names
3'-(Trifluoromethyl)-[1,1'-biphenyl]-2-carbaldehyde, ≥96%, ≥96% (CAS 223575-93-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BEDM-250mg |
| cas | 223575-93-7 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 544.40 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
2-[3-(trifluoromethyl)phenyl]benzaldehyde (CAS 223575-93-7) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: STRFWILZQHGWOK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | STRFWILZQHGWOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)