cas: 223575-93-7 — see every product listed under this CAS number, including other names
3'-Trifluoromethylbiphenyl-2-carbaldehyde (CAS 223575-93-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014313-250MG |
| cas | 223575-93-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 877.83 Pln |
| delivery time | 3-4 weeks |
|---|
2-[3-(trifluoromethyl)phenyl]benzaldehyde (CAS 223575-93-7) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: STRFWILZQHGWOK-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | STRFWILZQHGWOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)