cas: 935478-29-8 — see every product listed under this CAS number, including other names
3'-(tert-Butyl)-5'-formyl-4'-hydroxybiphenyl-4-carboxylic Acid, ≥95%, ≥95% (CAS 935478-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHNU-100mg |
| cas | 935478-29-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 1g | 1528.40 Pln | |
| Chemat | 5g | 4595.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid (CAS 935478-29-8) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid. InChIKey: WRHFIAQZSCZHQK-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 4-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzoic acid |
| InChIKey | WRHFIAQZSCZHQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)