CAS 34068-01-4 appears in our catalog under these names: Terbutaline Impurity 25, 3-Benzyloxyacetophenone, 3'-Benzyloxyacetophenone, 97% , 3'-Benzyloxyacetophenone, >98.0%(GC), 1-(3-(Benzyloxy)phenyl)ethanone 98%. Offered by: Chemat Brand, TRC, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: on request, 1g, 5g, 25g, 100g, 500g, 10g, 50g.
1-(3-phenylmethoxyphenyl)ethanone (CAS 34068-01-4) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 1-(3-phenylmethoxyphenyl)ethanone. InChIKey: FGQMEAWGAUALJQ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 1-(3-phenylmethoxyphenyl)ethanone |
| InChIKey | FGQMEAWGAUALJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)