Products 175153-13-6

CAS 175153-13-6 is the registry number for 3,4'-Dimethyl-[1,1'-biphenyl]-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-4-(4-methylphenyl)benzoic acid (CAS 175153-13-6) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-methyl-4-(4-methylphenyl)benzoic acid. InChIKey: LQIOEAYPILVWDF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O2
Molecular weight226.27 g/mol
IUPAC name2-methyl-4-(4-methylphenyl)benzoic acid
InChIKeyLQIOEAYPILVWDF-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CC(=C(C=C2)C(=O)O)C

Computed by PubChem (NCBI)