Products 1708738-98-0
CAS 1708738-98-0 appears in our catalog under these names: 4',5-Dimethyl-[1,1'-biphenyl]-3-carboxylic acid, 95%, 4',5-Dimethyl-(1,1'-biphenyl)-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-methyl-5-(4-methylphenyl)benzoic acid (CAS 1708738-98-0) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-methyl-5-(4-methylphenyl)benzoic acid. InChIKey: JIGPGBJMTWZRDX-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-methyl-5-(4-methylphenyl)benzoic acid |
| InChIKey | JIGPGBJMTWZRDX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC(=C2)C)C(=O)O |
Computed by PubChem (NCBI)