CAS 364070-34-8 appears in our catalog under these names: 4-(2,6-Dimethylphenyl)benzoic acid, 95%, 4–(2,6–Dimethylphenyl)benzoic acid, 4-(2,6-Dimethylphenyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-(2,6-dimethylphenyl)benzoic acid (CAS 364070-34-8) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 4-(2,6-dimethylphenyl)benzoic acid. InChIKey: LDNLTMRRJNZNRE-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-(2,6-dimethylphenyl)benzoic acid |
| InChIKey | LDNLTMRRJNZNRE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)