Products 59793-29-2
CAS 59793-29-2 appears in our catalog under these names: Methyl 2-([1,1'-biphenyl]-4-yl)acetate 97%, Methyl 2-([1,1'-biphenyl]-4-yl)acetate, 98%, [1,1'-Biphenyl]-4-acetic acid methyl ester, 95%, Felbinac Methyl Ester, [1,1'-Biphenyl]-4-acetic acid methyl ester, 98%, 98%. Offered by: Ambeed, Fluorochem, Combi-blocks, Mikromol, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 500mg, 10g.
Methyl 2-(4-phenylphenyl)acetate (CAS 59793-29-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 2-(4-phenylphenyl)acetate. InChIKey: SRIBJRZQDFBVQC-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 2-(4-phenylphenyl)acetate |
| InChIKey | SRIBJRZQDFBVQC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
4-Biphenylylacetic acid methyl ester, [1,1'-Biphenyl]-4-acetic acid methyl ester, methyl 2-([1,1'-biphenyl]-4-yl)acetate, methyl 2-(4-phenylphenyl)acetate, biphenyl-4-yl-acetic acid methyl ester, Bpaa-Me, Felbinac Impurity 7, Felbinac Methyl Ester, Felbinacgel Impurity 3, methyl biphenyl-4-ylacetate