cas: 400744-49-2 — see every product listed under this CAS number, including other names
3'-Chloro-[1,1'-biphenyl]-4-carbaldehyde 98% (CAS 400744-49-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A959526-250mg |
| cas | 400744-49-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1037.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A959526 |
4-(3-chlorophenyl)benzaldehyde (CAS 400744-49-2) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 4-(3-chlorophenyl)benzaldehyde. InChIKey: SQMLKQSDIZEGRP-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 4-(3-chlorophenyl)benzaldehyde |
| InChIKey | SQMLKQSDIZEGRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)