cas: 216443-25-3 — see every product listed under this CAS number, including other names
3'-Chlorobiphenyl-2-carbaldehyde, 97% (CAS 216443-25-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014288-500MG |
| cas | 216443-25-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1403.69 Pln | |
| Fluorochem | 1g | 2059.71 Pln | |
| Fluorochem | 5g | 6016.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-chlorophenyl)benzaldehyde (CAS 216443-25-3) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 2-(3-chlorophenyl)benzaldehyde. InChIKey: QPYBBMYVPFPRHE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-(3-chlorophenyl)benzaldehyde |
| InChIKey | QPYBBMYVPFPRHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)