CAS 676348-32-6 is the registry number for 3'-Fluoro-(1,1'-biphenyl)-2-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3-fluorophenyl)benzaldehyde (CAS 676348-32-6) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 2-(3-fluorophenyl)benzaldehyde. InChIKey: QWVXKCNJWQODSR-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(3-fluorophenyl)benzaldehyde |
| InChIKey | QWVXKCNJWQODSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)