cas: 475231-21-1 — see every product listed under this CAS number, including other names
3'-Hydroxypterostilbene 99% (CAS 475231-21-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A249939-1mg |
| cas | 475231-21-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 147.88 Pln | |
| Ambeed | 5mg | 242.44 Pln | |
| Ambeed | 10mg | 337.00 Pln | |
| Ambeed | 25mg | 598.44 Pln | |
| Ambeed | 50mg | 954.44 Pln | |
| Ambeed | 100mg | 1399.44 Pln | |
| Ambeed | 250mg | 2066.94 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A249939 |
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzene-1,2-diol (CAS 475231-21-1) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzene-1,2-diol. InChIKey: UQRBFXIUUDJHSN-ONEGZZNKSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]benzene-1,2-diol |
| InChIKey | UQRBFXIUUDJHSN-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C/C2=CC(=C(C=C2)O)O)OC |
Computed by PubChem (NCBI)