Products 2379321-30-7

CAS 2379321-30-7 is the registry number for 4-(Benzyloxy)-2-(methoxymethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(methoxymethyl)-4-phenylmethoxybenzoic acid (CAS 2379321-30-7) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2-(methoxymethyl)-4-phenylmethoxybenzoic acid. InChIKey: GZXXZGJMPCQPCX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O4
Molecular weight272.29 g/mol
IUPAC name2-(methoxymethyl)-4-phenylmethoxybenzoic acid
InChIKeyGZXXZGJMPCQPCX-UHFFFAOYSA-N
SMILESCOCC1=C(C=CC(=C1)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)