cas: 588-04-5 — see every product listed under this CAS number, including other names
3,3'-Dimethylazobenzene, >98.0%(GC) (CAS 588-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0676-1G |
| cas | 588-04-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 251.11 Pln | |
| TCI | 5g | 757.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Bis(3-methylphenyl)diazene (CAS 588-04-5) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: bis(3-methylphenyl)diazene. InChIKey: HPSZIXYLILUGIP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(3-methylphenyl)diazene |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)