CAS 1437051-62-1 appears in our catalog under these names: 3,3,6-Trimethylbenzo[c][1,2]oxaborol-1(3H)-ol, 95%, 95%, 3,3,6-Trimethylbenzo[c][1,2]oxaborol-1(3H)-ol, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole (CAS 1437051-62-1) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: 1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole. InChIKey: YHLJNIYISMRAQQ-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | 1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole |
| InChIKey | YHLJNIYISMRAQQ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)C)C(O1)(C)C)O |
Computed by PubChem (NCBI)