CAS 852603-86-2 is the registry number for ((1E)-4-Phenyl-1-buten-1-yl)boronic Acid. Offered by: TRC. Available pack sizes: 250mg.
[(E)-4-phenylbut-1-enyl]boronic acid (CAS 852603-86-2) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: [(E)-4-phenylbut-1-enyl]boronic acid. InChIKey: NZUZZHVYWNGTAL-WEVVVXLNSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | [(E)-4-phenylbut-1-enyl]boronic acid |
| InChIKey | NZUZZHVYWNGTAL-WEVVVXLNSA-N |
| SMILES | B(/C=C/CCC1=CC=CC=C1)(O)O |
Computed by PubChem (NCBI)