CAS 2225181-58-6 is the registry number for 3–Methyl–2–cyclopropylphenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(2-cyclopropyl-3-methylphenyl)boronic acid (CAS 2225181-58-6) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: (2-cyclopropyl-3-methylphenyl)boronic acid. InChIKey: RVCNIVAEZKZRBS-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | (2-cyclopropyl-3-methylphenyl)boronic acid |
| InChIKey | RVCNIVAEZKZRBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)C2CC2)(O)O |
Computed by PubChem (NCBI)