3,4'-DIMETHYLBIPHENYL, 95%
cas: 7383-90-6 — see every product listed under this CAS number, including other names
3,4'-DIMETHYLBIPHENYL, 95% (CAS 7383-90-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F472077-250MG |
| cas | 7383-90-6 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1263.11 Pln | |
| Fluorochem | 25g | 4022.56 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1082.38 Pln | |
| Ambeed | 25g | 3613.31 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 755.60 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2416.40 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-methyl-3-(4-methylphenyl)benzene (CAS 7383-90-6) is a chemical compound with the molecular formula C14H14 and a molecular weight of 182.26 g/mol. IUPAC name: 1-methyl-3-(4-methylphenyl)benzene. InChIKey: RBIDPZJTXCPESJ-UHFFFAOYSA-N.
| Molecular formula | C14H14 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 1-methyl-3-(4-methylphenyl)benzene |
| InChIKey | RBIDPZJTXCPESJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)